CymitQuimica logo

CAS 1173897-84-1

:

3-Methyl-6-(trifluoromethyl)pyridazine

Description:
3-Methyl-6-(trifluoromethyl)pyridazine is a heterocyclic organic compound characterized by its pyridazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 2. The presence of a methyl group at the 3-position and a trifluoromethyl group at the 6-position significantly influences its chemical properties and reactivity. This compound is typically colorless to pale yellow in appearance and may exhibit moderate to high polarity due to the electronegative trifluoromethyl group, which can enhance its solubility in polar solvents. The trifluoromethyl group also contributes to the compound's potential biological activity and stability, making it of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, the presence of nitrogen atoms in the ring can affect its basicity and potential interactions with other chemical species. Overall, 3-Methyl-6-(trifluoromethyl)pyridazine is a versatile compound with unique characteristics that can be leveraged in synthetic and applied chemistry.
Formula:C6H5F3N2
InChI:InChI=1S/C6H5F3N2/c1-4-2-3-5(11-10-4)6(7,8)9/h2-3H,1H3
InChI key:InChIKey=KYJDVSWQDDEOGP-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC=C(C)N=N1
Synonyms:
  • Pyridazine, 3-methyl-6-(trifluoromethyl)-
  • 3-Methyl-6-(trifluoromethyl)pyridazine
Found 3 products.