CymitQuimica logo

CAS 1173897-86-3

:

5-Bromo-6-methyl-2-pyridinecarbonitrile

Description:
5-Bromo-6-methyl-2-pyridinecarbonitrile is a heterocyclic organic compound characterized by its pyridine ring, which contains both a bromine atom and a cyano group. The presence of the bromine atom at the 5-position and a methyl group at the 6-position contributes to its unique reactivity and physical properties. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure allows for potential applications in pharmaceuticals and agrochemicals, particularly as an intermediate in the synthesis of biologically active compounds. The cyano group enhances its reactivity, making it a useful building block in organic synthesis. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and characterization. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed in laboratory settings.
Formula:C7H5BrN2
InChI:InChI=1S/C7H5BrN2/c1-5-7(8)3-2-6(4-9)10-5/h2-3H,1H3
InChI key:InChIKey=NFJCCSONEBUNGR-UHFFFAOYSA-N
SMILES:C(#N)C=1N=C(C)C(Br)=CC1
Synonyms:
  • 2-Pyridinecarbonitrile, 5-bromo-6-methyl-
  • 5-Bromo-6-methyl-2-pyridinecarbonitrile
Found 5 products.