CymitQuimica logo

CAS 117391-49-8

:

3-Amino-3-(2-Fluoro-Phenyl)-Propionic Acid

Description:
3-Amino-3-(2-Fluoro-Phenyl)-Propionic Acid, with the CAS number 117391-49-8, is an amino acid derivative characterized by the presence of an amino group, a propionic acid backbone, and a fluorinated phenyl group. This compound features a fluorine atom attached to the aromatic ring, which can influence its chemical reactivity and biological activity. The amino group contributes to its classification as an amino acid, while the propionic acid moiety provides acidic properties. The presence of the fluorine substituent may enhance lipophilicity and alter the compound's interaction with biological targets, making it of interest in medicinal chemistry and drug design. Its structural characteristics suggest potential applications in pharmaceuticals, particularly in the development of compounds that modulate neurotransmitter systems or exhibit neuroprotective effects. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of study for various chemical and biological applications.
Formula:C9H10FNO2
InChI:InChI=1/C9H10FNO2/c10-7-4-2-1-3-6(7)8(11)5-9(12)13/h1-4,8H,5,11H2,(H,12,13)
InChI key:RSCLTSJQAQBNCE-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)C(CC(=O)O)N)F
Synonyms:
  • Rarechem Ak Hc T305
  • 3-Amino-3-(2-Fluorophenyl)Propanoic Acid
  • DL-3-Amino-3-(2-Fluoro-Phenyl)-Propionic Acid
  • 4-(Piperidin-1-Yl)Benzoic Acid
Found 3 products.