CymitQuimica logo

CAS 1174020-43-9

:

tert-butyl (3R,4R)-3-fluoro-4-hydroxypiperidine-1-carboxylate

Description:
Tert-butyl (3R,4R)-3-fluoro-4-hydroxypiperidine-1-carboxylate is a chemical compound characterized by its piperidine ring structure, which features a tert-butyl ester group and a hydroxyl group at the 4-position, along with a fluorine atom at the 3-position. This compound is typically used in organic synthesis and medicinal chemistry due to its potential biological activity. The presence of the fluorine atom can enhance the lipophilicity and metabolic stability of the molecule, making it a valuable scaffold in drug design. The stereochemistry indicated by the (3R,4R) configuration suggests specific spatial arrangements of the substituents, which can significantly influence the compound's reactivity and interaction with biological targets. Additionally, the tert-butyl group contributes to the overall hydrophobic character of the molecule, which may affect its solubility and permeability in biological systems. Overall, this compound exemplifies the importance of structural features in determining the properties and applications of chemical substances in various fields.
Formula:C10H18FNO3
InChI:InChI=1S/C10H18FNO3/c1-10(2,3)15-9(14)12-5-4-8(13)7(11)6-12/h7-8,13H,4-6H2,1-3H3/t7-,8-/m1/s1
InChI key:XRNLYXKYODGLMI-HTQZYQBOSA-N
SMILES:CC(C)(C)OC(=O)N1CC[C@H]([C@@H](C1)F)O
Found 4 products.