CymitQuimica logo

CAS 1174020-50-8

:

1,1-Dimethylethyl (3R,4R)-3-fluoro-4-hydroxy-1-pyrrolidinecarboxylate

Description:
1,1-Dimethylethyl (3R,4R)-3-fluoro-4-hydroxy-1-pyrrolidinecarboxylate, with the CAS number 1174020-50-8, is a chemical compound characterized by its pyrrolidine structure, which includes a carboxylate functional group. The presence of a fluorine atom at the 3-position and a hydroxyl group at the 4-position contributes to its unique reactivity and potential biological activity. The dimethyl group at the 1-position enhances steric hindrance, which may influence the compound's interaction with biological targets. This compound is likely to exhibit polar characteristics due to the hydroxyl group, affecting its solubility in various solvents. Additionally, the stereochemistry indicated by the (3R,4R) configuration suggests specific spatial arrangements that can impact its pharmacological properties. Such compounds are often of interest in medicinal chemistry for their potential therapeutic applications, particularly in the development of pharmaceuticals targeting specific biological pathways. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C9H16FNO3
InChI:InChI=1S/C9H16FNO3/c1-9(2,3)14-8(13)11-4-6(10)7(12)5-11/h6-7,12H,4-5H2,1-3H3/t6-,7-/m1/s1
InChI key:InChIKey=KTBDFQPHEPDHQW-RNFRBKRXSA-N
SMILES:C(OC(C)(C)C)(=O)N1C[C@@H](F)[C@H](O)C1
Synonyms:
  • (3R,4R)-tert-Butyl 3-hydroxy-4-fluoropyrrolidine-1-carboxylate
  • tert-Butyl (3R,4R)-3-fluoro-4-hydroxypyrrolidine-1-carboxylate
  • 1-Pyrrolidinecarboxylic acid, 3-fluoro-4-hydroxy-, 1,1-dimethylethyl ester, (3R,4R)-
  • 1,1-Dimethylethyl (3R,4R)-3-fluoro-4-hydroxy-1-pyrrolidinecarboxylate
Found 4 products.