CymitQuimica logo

CAS 1174028-20-6

:

5-Bromo-6-methyl-3-pyridinecarboxaldehyde

Description:
5-Bromo-6-methyl-3-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methyl group at the 6-position of the pyridine ring contributes to its unique reactivity and physical properties. The aldehyde functional group at the 3-position is significant for its chemical behavior, making it a potential candidate for various synthetic applications, including in the development of pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its reactivity can be influenced by the electron-withdrawing nature of the bromine atom and the electron-donating properties of the methyl group, which can affect nucleophilic attack and other chemical transformations. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 5-Bromo-6-methyl-3-pyridinecarboxaldehyde is a valuable compound in organic synthesis and medicinal chemistry.
Formula:C7H6BrNO
InChI:InChI=1S/C7H6BrNO/c1-5-7(8)2-6(4-10)3-9-5/h2-4H,1H3
InChI key:YOKBWADWPYRVJS-UHFFFAOYSA-N
SMILES:CC1=C(C=C(C=N1)C=O)Br
Found 3 products.