CymitQuimica logo

CAS 1174028-23-9

:

5-Bromo-6-methyl-3-pyridinemethanol

Description:
5-Bromo-6-methyl-3-pyridinemethanol is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methyl group at the 6-position of the pyridine ring contributes to its unique reactivity and properties. The hydroxymethyl group (-CH2OH) at the 3-position enhances its potential for hydrogen bonding and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the bromine substituent can serve as a useful handle for further functionalization. The compound's stability, solubility, and reactivity can be influenced by the electronic effects of the substituents on the pyridine ring. Overall, 5-Bromo-6-methyl-3-pyridinemethanol is a versatile compound with potential applications in medicinal chemistry and organic synthesis.
Formula:C7H8BrNO
InChI:InChI=1S/C7H8BrNO/c1-5-7(8)2-6(4-10)3-9-5/h2-3,10H,4H2,1H3
InChI key:InChIKey=KNZHIXOSCFEQEX-UHFFFAOYSA-N
SMILES:C(O)C=1C=C(Br)C(C)=NC1
Synonyms:
  • (5-Bromo-6-methyl-3-pyridinyl)methanol
  • 5-Bromo-6-methyl-3-pyridinemethanol
  • 3-Pyridinemethanol, 5-bromo-6-methyl-
Found 3 products.