CymitQuimica logo

CAS 1174064-62-0

:

4-(4-Bromo-1H-pyrazol-1-yl)benzenesulfonyl chloride

Description:
4-(4-Bromo-1H-pyrazol-1-yl)benzenesulfonyl chloride is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a benzene ring, which is further substituted with a 4-bromo-1H-pyrazole moiety. This compound typically appears as a solid and is known for its reactivity due to the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. The presence of the bromine atom enhances its electrophilic character, making it useful in various synthetic applications, particularly in the development of pharmaceuticals and agrochemicals. The compound is likely to be soluble in organic solvents, and its reactivity can be influenced by the electronic effects of the substituents on the aromatic ring. Safety precautions should be taken when handling this substance, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or other nucleophiles. Overall, this compound serves as a versatile intermediate in organic synthesis.
Formula:C9H6BrClN2O2S
InChI:InChI=1S/C9H6BrClN2O2S/c10-7-5-12-13(6-7)8-1-3-9(4-2-8)16(11,14)15/h1-6H
InChI key:InChIKey=LRYXAJMNOSSJDD-UHFFFAOYSA-N
SMILES:BrC1=CN(C2=CC=C(S(Cl)(=O)=O)C=C2)N=C1
Synonyms:
  • Benzenesulfonyl chloride, 4-(4-bromo-1H-pyrazol-1-yl)-
  • 4-(4-Bromo-1H-pyrazol-1-yl)benzenesulfonyl chloride
Found 2 products.