CymitQuimica logo

CAS 1174068-79-1

:

1,1-Dimethylethyl 6-formyl-3,4-dihydropyrrolo[1,2-a]pyrazine-2(1H)-carboxylate

Description:
1,1-Dimethylethyl 6-formyl-3,4-dihydropyrrolo[1,2-a]pyrazine-2(1H)-carboxylate, with CAS number 1174068-79-1, is a chemical compound characterized by its complex structure, which includes a pyrrolo[1,2-a]pyrazine core. This compound features a formyl group and a carboxylate ester, contributing to its reactivity and potential applications in organic synthesis. The presence of the dimethyl group enhances its steric properties, influencing its interactions and stability. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry. The molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, which could affect solubility and reactivity. Additionally, the compound may undergo various chemical transformations, such as oxidation or reduction, depending on the reaction conditions. Overall, this substance represents a unique combination of functional groups that could be explored for various applications in pharmaceuticals or agrochemicals.
Formula:C13H18N2O3
InChI:InChI=1S/C13H18N2O3/c1-13(2,3)18-12(17)14-6-7-15-10(8-14)4-5-11(15)9-16/h4-5,9H,6-8H2,1-3H3
InChI key:InChIKey=LDGNAVIMUAPFKH-UHFFFAOYSA-N
SMILES:C(=O)C=1N2C(CN(C(OC(C)(C)C)=O)CC2)=CC1
Synonyms:
  • 1,1-Dimethylethyl 6-formyl-3,4-dihydropyrrolo[1,2-a]pyrazine-2(1H)-carboxylate
  • Pyrrolo[1,2-a]pyrazine-2(1H)-carboxylic acid, 6-formyl-3,4-dihydro-, 1,1-dimethylethyl ester
Found 3 products.