CymitQuimica logo

CAS 1175036-51-7

:

4-(piperazin-1-yl)phenol hydrochloride

Description:
4-(Piperazin-1-yl)phenol hydrochloride is a chemical compound characterized by its piperazine moiety linked to a phenolic group. This substance typically appears as a white to off-white crystalline powder and is soluble in water and various organic solvents, which enhances its utility in pharmaceutical formulations. The presence of the piperazine ring contributes to its potential biological activity, often associated with neuropharmacological effects. The hydrochloride salt form improves its stability and solubility, making it more suitable for medicinal applications. This compound may exhibit properties such as analgesic, anti-inflammatory, or antipsychotic effects, depending on its specific interactions with biological targets. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, 4-(piperazin-1-yl)phenol hydrochloride is of interest in medicinal chemistry and pharmacology, warranting further investigation for its therapeutic potential.
Formula:C10H15ClN2O
InChI:InChI=1S/C10H14N2O.ClH/c13-10-3-1-9(2-4-10)12-7-5-11-6-8-12;/h1-4,11,13H,5-8H2;1H
InChI key:HOQZYXZHPXPKCX-UHFFFAOYSA-N
SMILES:C1CN(CCN1)C2=CC=C(C=C2)O.Cl
Found 3 products.