CymitQuimica logo

CAS 117519-08-1

:

2-cloro-3-nitro-6-(trifluoromethyl) pyridine

Description:
2-Chloro-3-nitro-6-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a chlorine atom, a nitro group, and a trifluoromethyl group. The chlorine atom is located at the 2-position, the nitro group at the 3-position, and the trifluoromethyl group at the 6-position of the pyridine ring. This compound exhibits polar characteristics due to the electronegative substituents, which can influence its solubility in various solvents. The trifluoromethyl group enhances the compound's lipophilicity and may contribute to its biological activity. Additionally, the nitro group can participate in various chemical reactions, including reduction and nucleophilic substitution. The presence of multiple functional groups suggests potential applications in pharmaceuticals, agrochemicals, and materials science. Safety data should be consulted for handling, as compounds with halogenated and nitro groups can pose health and environmental risks. Overall, 2-chloro-3-nitro-6-(trifluoromethyl)pyridine is a versatile compound with significant chemical reactivity and potential applications.
Formula:C6H2ClF3N2O2
InChI:InChI=1/C6H2ClF3N2O2/c7-5-3(12(13)14)1-2-4(11-5)6(8,9)10/h1-2H
InChI key:RBLRRZSRLXGELK-UHFFFAOYSA-N
SMILES:c1cc(C(F)(F)F)nc(c1N(=O)=O)Cl
Synonyms:
  • 2-Chloro-3-nitro-6-(trifluoromethyl)pyridine
  • Pyridine, 2-Chloro-3-Nitro-6-(Trifluoromethyl)-
Found 4 products.