CymitQuimica logo

CAS 117519-19-4

:

2(1H)-Pyridinone, 5-nitro-6-(trifluoromethyl)-

Description:
2(1H)-Pyridinone, 5-nitro-6-(trifluoromethyl)-, with the CAS number 117519-19-4, is a heterocyclic organic compound characterized by a pyridinone core structure that features a nitro group and a trifluoromethyl group. The presence of the nitro group typically imparts significant polarity and can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. The trifluoromethyl group enhances the compound's lipophilicity and can affect its biological activity, often increasing the compound's potency in pharmaceutical applications. This compound may exhibit interesting properties such as antimicrobial or antifungal activity, making it relevant in medicinal chemistry. Additionally, its unique functional groups can lead to diverse applications in agrochemicals and materials science. As with many nitro-containing compounds, care should be taken regarding its handling and storage due to potential toxicity and environmental impact. Overall, 2(1H)-Pyridinone, 5-nitro-6-(trifluoromethyl)- is a compound of interest in various fields of chemical research.
Formula:C6H3F3N2O3
InChI:InChI=1/C6H3F3N2O3/c7-6(8,9)5-3(11(13)14)1-2-4(12)10-5/h1-2H,(H,10,12)
InChI key:UXJCQEGCBKLJAV-UHFFFAOYSA-N
SMILES:c1cc(nc(c1N(=O)=O)C(F)(F)F)O
Synonyms:
  • 2-Hydroxy-5-nitro-6-trifluoromethylpyridine
  • 5-nitro-6-(trifluoromethyl)-1H-pyridin-2-one
Found 3 products.