CymitQuimica logo

CAS 117528-58-2

:

2,4-Dichloro-3-cyano-5-fluorobenzoic acid

Description:
2,4-Dichloro-3-cyano-5-fluorobenzoic acid is an aromatic compound characterized by the presence of multiple halogen substituents and a cyano group on a benzoic acid framework. This compound features two chlorine atoms at the 2 and 4 positions, a fluorine atom at the 5 position, and a cyano group at the 3 position of the benzene ring. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including agrochemicals and pharmaceuticals. The carboxylic acid functional group imparts acidic properties, allowing for potential interactions with bases and other nucleophiles. Additionally, the halogen substituents can enhance lipophilicity and influence the compound's biological activity. The compound's molecular structure suggests it may exhibit unique physical properties, such as solubility in organic solvents and varying melting and boiling points, depending on the specific conditions. Overall, 2,4-Dichloro-3-cyano-5-fluorobenzoic acid is a versatile compound with significant implications in chemical research and application.
Formula:C8H2Cl2FNO2
InChI:InChI=1S/C8H2Cl2FNO2/c9-6-3(8(13)14)1-5(11)7(10)4(6)2-12/h1H,(H,13,14)
InChI key:PAJAHSZQWFSIFX-UHFFFAOYSA-N
SMILES:C1=C(C(=C(C(=C1F)Cl)C#N)Cl)C(=O)O
Synonyms:
  • Benzoic acid, 2,4-dichloro-3-cyano-5-fluoro-
  • 3-Cyano-2,4-dichloro-5-fluorobenzoic acid
Found 5 products.