CymitQuimica logo

CAS 1175512-08-9

:

Methyl 5-bromo-4-hydroxynicotinate

Description:
Methyl 5-bromo-4-hydroxynicotinate is a chemical compound that belongs to the class of nicotinic acid derivatives. It features a bromine atom at the 5-position and a hydroxyl group at the 4-position of the pyridine ring, along with a methyl ester functional group. This compound is characterized by its potential biological activity, particularly in medicinal chemistry, where it may exhibit properties relevant to pharmacology. The presence of the bromine atom can influence its reactivity and interactions with biological targets. The hydroxyl group contributes to its polarity, potentially enhancing solubility in polar solvents. Methyl 5-bromo-4-hydroxynicotinate may be synthesized through various organic reactions, including bromination and esterification processes. Its applications could extend to areas such as drug development, where it may serve as a lead compound or a building block for more complex molecules. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C7H6BrNO3
InChI:InChI=1S/C7H6BrNO3/c1-12-7(11)4-2-9-3-5(8)6(4)10/h2-3H,1H3,(H,9,10)
InChI key:MOSJHTAFHHUNRB-UHFFFAOYSA-N
SMILES:COC(=O)c1c[nH]cc(c1=O)Br
Found 4 products.