CymitQuimica logo

CAS 117559-36-1

:

3-[ethoxy(dipropan-2-yl)silyl]propan-1-amine

Description:
3-[Ethoxy(dipropan-2-yl)silyl]propan-1-amine, identified by its CAS number 117559-36-1, is an organosilicon compound characterized by the presence of a silicon atom bonded to an ethoxy group and a dipropan-2-yl group, along with a propan-1-amine moiety. This compound typically exhibits properties associated with both organic and inorganic substances, such as moderate polarity due to the presence of the amine and ethoxy groups, and potential hydrophobic characteristics from the silane component. It may be utilized in various applications, including as a coupling agent, surface modifier, or in the synthesis of more complex silane derivatives. The presence of the amine group suggests potential reactivity, allowing for interactions with other chemical species, which can be advantageous in polymer chemistry or materials science. Additionally, the compound's structure may impart unique physical properties, such as viscosity and thermal stability, making it suitable for specific industrial applications. Safety and handling precautions should be observed, as with all chemical substances, due to potential reactivity and toxicity.
Formula:C11H27NOSi
InChI:InChI=1/C11H27NOSi/c1-6-13-14(10(2)3,11(4)5)9-7-8-12/h10-11H,6-9,12H2,1-5H3
InChI key:FSMHYZUFHYGNHS-UHFFFAOYSA-N
SMILES:CCO[Si](CCCN)(C(C)C)C(C)C
Found 4 products.