CymitQuimica logo

CAS 1176202-63-3

:

1,3-Di(adamantan-1-yl)-4,5-dihydro-1H-imidazol-3-ium tetrafluoroborate

Description:
1,3-Di(adamantan-1-yl)-4,5-dihydro-1H-imidazol-3-ium tetrafluoroborate is a chemical compound characterized by its unique structure, which includes an imidazolium cation and a tetrafluoroborate anion. The presence of adamantane moieties contributes to its rigidity and steric bulk, which can influence its solubility and reactivity. This compound is typically used in organic synthesis and as a potential ionic liquid, owing to its ionic nature and the stability provided by the tetrafluoroborate anion. The imidazolium cation can participate in various chemical reactions, including nucleophilic substitutions and coordination chemistry. Additionally, the compound may exhibit interesting properties such as thermal stability and conductivity, making it suitable for applications in materials science and electrochemistry. Its specific interactions and behavior in different solvents or under varying conditions can be further explored to understand its potential uses in various chemical processes.
Formula:C23H35BF4N2
InChI:InChI=1S/C23H35N2.BF4/c1-2-25(23-12-19-6-20(13-23)8-21(7-19)14-23)15-24(1)22-9-16-3-17(10-22)5-18(4-16)11-22;2-1(3,4)5/h15-21H,1-14H2;/q+1;-1
InChI key:ROPJORVKBRTKMW-UHFFFAOYSA-N
SMILES:[B-](F)(F)(F)F.C1C[N+](=CN1C23CC4CC(C2)CC(C4)C3)C56CC7CC(C5)CC(C7)C6
Found 3 products.