CymitQuimica logo

CAS 117621-06-4

:

2-(2-Methoxyphenyl)-5-oxotetrahydrofuran-3-carboxylic acid

Description:
2-(2-Methoxyphenyl)-5-oxotetrahydrofuran-3-carboxylic acid, with the CAS number 117621-06-4, is a chemical compound characterized by its unique structure, which includes a tetrahydrofuran ring, a carboxylic acid functional group, and a methoxy-substituted phenyl group. This compound typically exhibits properties associated with both the tetrahydrofuran moiety and the carboxylic acid, such as solubility in polar solvents and potential reactivity due to the presence of the carboxylic acid group. It may participate in various chemical reactions, including esterification and amidation, due to its functional groups. The methoxy group can influence the compound's electronic properties and steric hindrance, potentially affecting its reactivity and interactions with biological systems. Such compounds may be of interest in medicinal chemistry and organic synthesis, where they could serve as intermediates or lead compounds for further development. As with many organic compounds, safety data should be consulted to understand any hazards associated with handling and usage.
Formula:C12H12O5
InChI:InChI=1/C12H12O5/c1-16-9-5-3-2-4-7(9)11-8(12(14)15)6-10(13)17-11/h2-5,8,11H,6H2,1H3,(H,14,15)
InChI key:LMMNYYZCVYAOOF-UHFFFAOYSA-N
SMILES:COc1ccccc1C1C(CC(=O)O1)C(=O)O
Synonyms:
  • 3-Furancarboxylic Acid, Tetrahydro-2-(2-Methoxyphenyl)-5-Oxo-
Found 3 products.