CymitQuimica logo

CAS 117623-46-8

:

1-benzyl-2,2-dimethylpiperidin-4-one

Description:
1-Benzyl-2,2-dimethylpiperidin-4-one, with the CAS number 117623-46-8, is a chemical compound that belongs to the class of piperidine derivatives. It features a piperidine ring substituted with a benzyl group and two methyl groups at the 2-position, along with a ketone functional group at the 4-position. This structure contributes to its unique chemical properties, including its potential as a building block in organic synthesis and medicinal chemistry. The compound is typically characterized by its solid state at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity can be influenced by the presence of the ketone group, making it a candidate for various chemical transformations. Additionally, the presence of the benzyl group may enhance its lipophilicity, potentially affecting its biological activity. As with many piperidine derivatives, it may exhibit interesting pharmacological properties, although specific biological activities would require further investigation. Safety data and handling precautions should be considered when working with this compound in a laboratory setting.
Formula:C14H19NO
InChI:InChI=1S/C14H19NO/c1-14(2)10-13(16)8-9-15(14)11-12-6-4-3-5-7-12/h3-7H,8-11H2,1-2H3
InChI key:QXCCSKIRCJMSMM-UHFFFAOYSA-N
SMILES:CC1(CC(=O)CCN1CC2=CC=CC=C2)C
Found 3 products.