CymitQuimica logo

CAS 1176414-91-7

:

5-Bromo-1,2,3,4-tetrahydro-1-methylisoquinoline

Description:
5-Bromo-1,2,3,4-tetrahydro-1-methylisoquinoline is a chemical compound characterized by its isoquinoline structure, which consists of a bicyclic system containing a benzene ring fused to a pyridine ring. The presence of a bromine atom at the 5-position and a methyl group at the 1-position contributes to its unique reactivity and potential biological activity. This compound is typically a colorless to pale yellow solid and is soluble in organic solvents. Its tetrahydro form indicates that it has undergone partial hydrogenation, resulting in a saturated structure that may influence its pharmacological properties. Compounds of this class are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The bromine substituent can enhance the compound's lipophilicity and may play a role in its interaction with biological targets. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H12BrN
InChI:InChI=1S/C10H12BrN/c1-7-8-3-2-4-10(11)9(8)5-6-12-7/h2-4,7,12H,5-6H2,1H3
InChI key:InChIKey=VPKHWEFDYAMWOS-UHFFFAOYSA-N
SMILES:BrC1=C2C(C(C)NCC2)=CC=C1
Synonyms:
  • 5-Bromo-1-methyl-1,2,3,4-tetrahydroisoquinoline
  • 5-Bromo-1,2,3,4-tetrahydro-1-methylisoquinoline
  • Isoquinoline, 5-bromo-1,2,3,4-tetrahydro-1-methyl-
Found 5 products.