CymitQuimica logo

CAS 1176414-95-1

:

7-Bromo-1,2,3,4-tetrahydro-1-methylisoquinoline

Description:
7-Bromo-1,2,3,4-tetrahydro-1-methylisoquinoline is a chemical compound characterized by its bicyclic structure, which includes a tetrahydroisoquinoline framework with a bromine substituent at the 7-position and a methyl group at the nitrogen atom. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It exhibits properties common to isoquinoline derivatives, such as potential biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of the bromine atom can influence its reactivity and solubility, potentially enhancing its interaction with biological targets. Additionally, the tetrahydro configuration contributes to its stereochemistry, which may affect its pharmacokinetic properties. As with many organic compounds, it is important to handle it with care, considering safety protocols due to its potential toxicity and reactivity. Overall, 7-Bromo-1,2,3,4-tetrahydro-1-methylisoquinoline represents a valuable compound for research in various chemical and biological applications.
Formula:C10H12BrN
InChI:InChI=1S/C10H12BrN/c1-7-10-6-9(11)3-2-8(10)4-5-12-7/h2-3,6-7,12H,4-5H2,1H3
InChI key:InChIKey=XACRZPKKWVBSHB-UHFFFAOYSA-N
SMILES:CC1C=2C(=CC=C(Br)C2)CCN1
Found 3 products.