
CAS 117647-40-2
:Poly[oxy(1-oxo-1,3-propanediyl)], α-hydro-ω-[(1-oxo-2-propen-1-yl)oxy]-
Description:
Poly[oxy(1-oxo-1,3-propanediyl)], α-hydro-ω-[(1-oxo-2-propen-1-yl)oxy]- is a synthetic polymer characterized by its structure, which includes repeating units derived from 1-oxo-1,3-propanediyl and 1-oxo-2-propen-1-yl moieties. This polymer typically exhibits properties such as good solubility in various solvents, making it useful in applications like coatings, adhesives, and sealants. Its chemical structure allows for potential reactivity, enabling it to participate in further chemical modifications or cross-linking reactions. The presence of hydroxyl groups contributes to its hydrophilicity, enhancing its compatibility with water-based systems. Additionally, the polymer's molecular weight can vary, influencing its physical properties such as viscosity and mechanical strength. Overall, this substance is notable for its versatility in industrial applications, particularly in formulations requiring specific rheological and adhesive characteristics. Safety data and handling precautions should be observed, as with any chemical substance, to ensure safe usage in various applications.
Formula:(C3H4O2)nC3H4O2
InChI:InChI=1S/C6H8O4/c1-2-6(9)10-4-3-5(7)8/h2H,1,3-4H2,(H,7,8)
InChI key:CYUZOYPRAQASLN-UHFFFAOYSA-N
SMILES:C=CC(=O)OCCC(=O)O
Synonyms:- Poly[oxy(1-oxo-1,3-propanediyl)], α-hydro-ω-[(1-oxo-2-propenyl)oxy]-
- Poly[oxy(1-oxo-1,3-propanediyl)], α-hydro-ω-[(1-oxo-2-propen-1-yl)oxy]-
- M 5600
- Aronix M 5600
- β-Propiolactone homopolymer, SRU monoacrylate
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Poly[oxy(1-oxo-1,3-propanediyl)], α-hydro-ω-[(1-oxo-2-propen-1-yl)oxy]-
CAS:Formula:C6H8O4Molecular weight:144.1253

