CymitQuimica logo

CAS 1176667-93-8

:

3-Bromo-β,β-dimethylbenzeneethanamine

Description:
3-Bromo-β,β-dimethylbenzeneethanamine, also known as a substituted phenethylamine, is a chemical compound characterized by the presence of a bromine atom and two methyl groups on the benzene ring, along with an ethylamine side chain. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The bromine substituent can affect the compound's reactivity, potentially making it a candidate for further chemical transformations. The presence of the dimethyl groups can also influence steric hindrance and electronic properties, impacting its interaction with biological systems or other chemical entities. As with many amines, it may exhibit physiological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose specific health risks. Overall, the unique structural features of 3-Bromo-β,β-dimethylbenzeneethanamine contribute to its potential applications in research and industry.
Formula:C10H14BrN
InChI:InChI=1S/C10H14BrN/c1-10(2,7-12)8-4-3-5-9(11)6-8/h3-6H,7,12H2,1-2H3
InChI key:InChIKey=VBCFOJLKHKXQJJ-UHFFFAOYSA-N
SMILES:C(CN)(C)(C)C1=CC(Br)=CC=C1
Synonyms:
  • 3-Bromo-β,β-dimethylbenzeneethanamine
  • Benzeneethanamine, 3-bromo-β,β-dimethyl-
  • 2-(3-Bromophenyl)-2-methylpropan-1-amine
Found 1 products.