CymitQuimica logo

CAS 1176777-76-6

:

[1,1'-Biphenyl]-3-carboxylic acid, 3'-amino-2'-methoxy-

Description:
[1,1'-Biphenyl]-3-carboxylic acid, 3'-amino-2'-methoxy- is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid group (-COOH) at the 3-position of one phenyl ring contributes to its acidity and potential for forming hydrogen bonds, enhancing its solubility in polar solvents. The amino group (-NH2) at the 3'-position of the second phenyl ring introduces basicity and can participate in various chemical reactions, including nucleophilic substitutions. Additionally, the methoxy group (-OCH3) at the 2'-position provides electron-donating properties, influencing the compound's reactivity and stability. This compound may exhibit interesting biological activities due to its functional groups, making it a candidate for pharmaceutical applications. Its molecular structure allows for potential interactions with biological targets, and its properties can be further explored in synthetic chemistry and material science.
Formula:C14H13NO3
InChI:InChI=1S/C14H13NO3/c1-18-13-11(6-3-7-12(13)15)9-4-2-5-10(8-9)14(16)17/h2-8H,15H2,1H3,(H,16,17)
InChI key:XTGXSESGSWUDQN-UHFFFAOYSA-N
SMILES:COC1=C(C=CC=C1N)C2=CC(=CC=C2)C(=O)O
Synonyms:
  • 3'-amino-2'-methoxy-biphenyl-3-carboxylic acid
  • Eltrombopag Impurity K
  • [1,1'-Biphenyl]-3-carboxylic acid, 3'-amino-2'-methoxy-
  • 3'-amino-2'-methoxy-[1,1'-biphenyl]-3-carboxylic acid
Found 1 products.