CymitQuimica logo

CAS 117705-04-1

:

3-(2-oxopiperidin-1-yl)propanoic acid

Description:
3-(2-Oxopiperidin-1-yl)propanoic acid, with the CAS number 117705-04-1, is an organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a propanoic acid moiety, indicating the presence of a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The oxo group in the piperidine ring suggests that it has a ketone functionality, which can influence its chemical behavior and interactions. Typically, compounds like this may exhibit properties such as solubility in polar solvents due to the presence of the carboxylic acid group, and they may participate in various chemical reactions, including esterification and amide formation. Additionally, the structural features may confer biological activity, making it of interest in medicinal chemistry and drug development. Overall, the compound's unique structure and functional groups contribute to its potential applications in various chemical and pharmaceutical contexts.
Formula:C8H13NO3
InChI:InChI=1/C8H13NO3/c10-7-3-1-2-5-9(7)6-4-8(11)12/h1-6H2,(H,11,12)
InChI key:CZDCTKRGYQLASW-UHFFFAOYSA-N
SMILES:C1CCN(CCC(=O)O)C(=O)C1
Synonyms:
  • 1-Piperidinepropanoic Acid, 2-Oxo-
  • 3-(2-Oxopiperidin-1-yl)propanoic acid
Found 2 products.