CymitQuimica logo

CAS 117718-84-0

:

6-bromoimidazo[1,2-a]pyrazin-8-amine

Description:
6-Bromoimidazo[1,2-a]pyrazin-8-amine is a heterocyclic organic compound characterized by its fused imidazole and pyrazine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 6-position and an amino group at the 8-position enhances its reactivity and potential for forming various derivatives. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks have been explored for their biological activities, including antimicrobial and anticancer properties. Additionally, the presence of the bromine atom may facilitate further functionalization, making it a versatile building block in organic synthesis. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C6H5BrN4
InChI:InChI=1/C6H5BrN4/c7-4-3-11-2-1-9-6(11)5(8)10-4/h1-3H,(H2,8,10)
InChI key:PPVWNYGAZJHXFQ-UHFFFAOYSA-N
SMILES:c1cn2cc(Br)nc(c2n1)N
Synonyms:
  • Imidazo(1,2-a)pyrazin-8-amine, 6-bromo-
  • 8-Amino-6-bromoimidazo(1,2-a)pyrazine
  • Brn 5810118
Found 4 products.