CymitQuimica logo

CAS 117719-16-1

:

3-(4-Morpholinyl)-2-pyrazinamine

Description:
3-(4-Morpholinyl)-2-pyrazinamine, with the CAS number 117719-16-1, is a chemical compound characterized by its pyrazinamine core structure, which features a pyrazine ring substituted with an amino group and a morpholine moiety. This compound typically exhibits properties associated with both heterocyclic and amine functionalities, making it of interest in medicinal chemistry and pharmaceutical research. The morpholine group contributes to its potential as a pharmacophore, enhancing solubility and bioavailability. The presence of the amino group allows for hydrogen bonding interactions, which can influence its reactivity and binding affinity in biological systems. Additionally, the compound may exhibit moderate to high polarity, affecting its distribution and metabolism in biological contexts. Its specific applications may vary, but it is often explored for its potential therapeutic effects, particularly in the development of agents targeting various diseases. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C8H12N4O
InChI:InChI=1S/C8H12N4O/c9-7-8(11-2-1-10-7)12-3-5-13-6-4-12/h1-2H,3-6H2,(H2,9,10)
InChI key:InChIKey=NTDKLDOLZNULLH-UHFFFAOYSA-N
SMILES:NC=1C(N2CCOCC2)=NC=CN1
Synonyms:
  • 3-Morpholinopyrazin-2-amine
  • 3-(4-Morpholinyl)-2-pyrazinamine
  • (3-Morpholin-4-ylpyrazin-2-yl)amine
  • 2-Pyrazinamine, 3-(4-morpholinyl)-
  • Pyrazinamine, 3-(4-morpholinyl)-
Found 4 products.