CymitQuimica logo

CAS 117755-94-9

:

2-methyl-2-(4-methylanilino)propanoic acid

Description:
2-Methyl-2-(4-methylanilino)propanoic acid, with the CAS number 117755-94-9, is an organic compound characterized by its structure, which includes a propanoic acid backbone substituted with a methyl group and a 4-methylanilino group. This compound typically exhibits properties associated with carboxylic acids, such as acidity due to the presence of the carboxyl functional group (-COOH). It is likely to be a solid at room temperature, with potential solubility in polar solvents due to the carboxylic acid group. The presence of the aniline derivative may impart additional characteristics, such as potential for hydrogen bonding and varying degrees of hydrophobicity depending on the overall molecular structure. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its unique functional groups that can participate in chemical reactions or interactions. Safety and handling precautions should be observed, as with many organic compounds, particularly those containing amine and carboxylic acid functionalities.
Formula:C11H15NO2
InChI:InChI=1/C11H15NO2/c1-8-4-6-9(7-5-8)12-11(2,3)10(13)14/h4-7,12H,1-3H3,(H,13,14)
InChI key:SDRDMLFVFFTPAW-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)NC(C)(C)C(=O)O
Found 3 products.