CymitQuimica logo

CAS 117784-27-7

:

4-(4-Pyridinyl)-1H-pyrazole-3-carboxylic acid

Description:
4-(4-Pyridinyl)-1H-pyrazole-3-carboxylic acid, with the CAS number 117784-27-7, is a heterocyclic organic compound characterized by the presence of both a pyrazole and a pyridine ring in its structure. This compound features a carboxylic acid functional group, which contributes to its acidic properties and potential reactivity. The pyridine moiety typically imparts basic characteristics, while the pyrazole ring can exhibit various biological activities, making this compound of interest in medicinal chemistry. It is often studied for its potential applications in pharmaceuticals, particularly as a scaffold for developing new drugs. The compound is usually solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. Its unique structural features allow for various interactions with biological targets, which can be explored in drug design and development. Overall, 4-(4-Pyridinyl)-1H-pyrazole-3-carboxylic acid represents a versatile compound with significant implications in chemical and pharmaceutical research.
Formula:C9H7N3O2
InChI:InChI=1S/C9H7N3O2/c13-9(14)8-7(5-11-12-8)6-1-3-10-4-2-6/h1-5H,(H,11,12)(H,13,14)
InChI key:InChIKey=CZZVGBOCVFIZGU-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CNN1)C=2C=CN=CC2
Synonyms:
  • 1H-Pyrazole-3-carboxylic acid, 4-(4-pyridinyl)-
  • 4-(4-Pyridinyl)-1H-pyrazole-3-carboxylic acid
Found 2 products.