CymitQuimica logo

CAS 117803-96-0

:

16,24-Cycloergostan-26-oicacid, 1,7,11,12-tetrakis(acetyloxy)-2,3-epoxy-15,25-dihydroxy-6,23-dioxo-, d-lactone, (1a,2a,3a,5a,7b,11a,12a,15a,16b,25S)- (9CI)

Description:
16,24-Cycloergostan-26-oic acid, 1,7,11,12-tetrakis(acetyloxy)-2,3-epoxy-15,25-dihydroxy-6,23-dioxo-, d-lactone, with CAS number 117803-96-0, is a complex organic compound characterized by its multi-functional groups and stereochemistry. This substance features a cycloergostane backbone, which is a steroid-like structure, and includes multiple hydroxyl (-OH) groups, acetoxy (-OCOCH3) groups, and an epoxy group, contributing to its reactivity and potential biological activity. The presence of dioxo groups indicates that it may participate in redox reactions. The stereochemistry, denoted by the specific configuration at various carbon centers, suggests that the compound may exhibit unique interactions in biological systems, potentially influencing its pharmacological properties. As a lactone, it may also display characteristics typical of cyclic esters, such as stability and solubility in organic solvents. Overall, this compound's intricate structure suggests potential applications in medicinal chemistry or as a biochemical probe, although specific biological activities would require further investigation.
Formula:C36H46O14
InChI:InChI=1S/C36H46O14/c1-12-10-19(41)35(8)24-21(12)34(7)22(28(24)50-32(43)36(35,9)44)20-23(29(46-14(3)38)31(34)48-16(5)40)33(6)17(25(42)27(20)45-13(2)37)11-18-26(49-18)30(33)47-15(4)39/h12,17-18,20-24,26-31,44H,10-11H2,1-9H3/t12-,17-,18+,20+,21+,22-,23-,24+,26+,27-,28-,29+,30+,31+,33+,34-,35+,36-/m1/s1
InChI key:RXQVUONAHNHYNF-XSUQWDDVSA-N
SMILES:C[C@@H]1CC(=O)[C@]2([C@H]3[C@H]1[C@@]4([C@@H]([C@H]3OC(=O)[C@@]2(C)O)[C@H]5[C@H]([C@@H]([C@@H]4OC(=O)C)OC(=O)C)[C@@]6([C@H](C[C@H]7[C@@H]([C@@H]6OC(=O)C)O7)C(=O)[C@@H]5OC(=O)C)C)C)C
Synonyms:
  • 1H-Oxireno[6',7']naphtho[1',2':7,8]fluoreno[9,1-bc]pyran,16,24-cycloergostan-26-oic acid deriv.
  • Taccalonolide C
Found 6 products.