CymitQuimica logo

CAS 117832-15-2

:

3,5-DIMETHYL-4-IODOANILINE

Description:
3,5-Dimethyl-4-iodoaniline is an organic compound characterized by the presence of an aniline group substituted with both methyl and iodine functional groups. Its molecular structure features a benzene ring with two methyl groups located at the 3 and 5 positions and an iodine atom at the 4 position, which influences its reactivity and physical properties. This compound typically appears as a solid at room temperature and is known for its potential applications in organic synthesis, particularly in the production of dyes and pharmaceuticals. The presence of the iodine atom can enhance the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the methyl groups contribute to the compound's hydrophobic characteristics, affecting its solubility in different solvents. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental impact. Proper storage and disposal methods are essential to mitigate any risks associated with its use.
Formula:C8H10IN
InChI:InChI=1/C8H10IN/c1-5-3-7(10)4-6(2)8(5)9/h3-4H,10H2,1-2H3
InChI key:GVLJJTPNZDAXIJ-UHFFFAOYSA-N
SMILES:Cc1cc(cc(C)c1I)N
Synonyms:
  • 4-Iodo-3,5-Dimethylbenzenamine
  • 4-Iodo-3,5-Dimethylaniline
Found 4 products.