CymitQuimica logo

CAS 117832-18-5

:

2,4-Diiodo-5-methoxybenzenamine

Description:
2,4-Diiodo-5-methoxybenzenamine, with the CAS number 117832-18-5, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two iodine atoms and a methoxy group, as well as an amino group. The presence of the iodine atoms typically imparts significant electrophilic properties, making the compound potentially reactive in various chemical reactions. The methoxy group contributes to the compound's overall polarity and can influence its solubility in organic solvents. Additionally, the amino group can participate in hydrogen bonding, affecting the compound's physical properties such as melting and boiling points. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing other chemical entities. Its stability, reactivity, and interactions with other molecules can vary based on environmental conditions such as pH and temperature. Overall, 2,4-Diiodo-5-methoxybenzenamine presents a unique combination of functional groups that can be leveraged for diverse applications in research and industry.
Formula:C7H7I2NO
InChI:InChI=1S/C7H7I2NO/c1-11-7-3-6(10)4(8)2-5(7)9/h2-3H,10H2,1H3
InChI key:InChIKey=PBMVWEZIWGPXPX-UHFFFAOYSA-N
SMILES:O(C)C1=C(I)C=C(I)C(N)=C1
Synonyms:
  • Benzenamine, 2,4-diiodo-5-methoxy-
  • 2,4-Diiodo-5-methoxybenzenamine
  • 2,4-Diiodo-5-methoxyaniline
Found 2 products.