CymitQuimica logo

CAS 117837-77-1

:

4-Cyanobenzamidine Hydrochloride

Description:
4-Cyanobenzamidine Hydrochloride is a chemical compound characterized by its structural features, which include a cyanobenzamidine moiety. It is typically presented as a white to off-white crystalline powder and is soluble in water and various organic solvents, making it suitable for diverse applications in research and pharmaceutical contexts. The compound is known for its role as a potent inhibitor of certain enzymes, particularly serine proteases, which has implications in drug development and biochemical research. Its hydrochloride salt form enhances its stability and solubility, facilitating its use in biological assays. Additionally, 4-Cyanobenzamidine Hydrochloride exhibits a range of biological activities, including potential anti-inflammatory and anti-cancer properties, although further studies are often required to fully elucidate its mechanisms of action and therapeutic potential. As with many chemical substances, proper handling and safety precautions are essential due to its potential toxicity and reactivity.
Formula:C8H8ClN3
InChI:InChI=1S/C8H7N3.ClH/c9-5-6-1-3-7(4-2-6)8(10)11;/h1-4H,(H3,10,11);1H
InChI key:IKVRHGPKSBUMIO-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C#N)C(=N)N.Cl
Found 3 products.