CymitQuimica logo

CAS 117845-24-6

:

5-Bromo-N-cyclohexyl-2-furancarboxamide

Description:
5-Bromo-N-cyclohexyl-2-furancarboxamide is an organic compound characterized by its unique structural features, which include a furan ring, a bromine substituent, and a cyclohexyl group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The furan moiety contributes to the compound's aromatic properties, while the carboxamide functional group enhances its solubility in polar solvents and may influence its biological activity. This compound is typically synthesized through specific organic reactions that involve the introduction of the bromine atom and the cyclohexyl group onto the furan structure. Its applications may span across pharmaceuticals, agrochemicals, or materials science, depending on its biological activity and chemical reactivity. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, 5-Bromo-N-cyclohexyl-2-furancarboxamide represents a versatile structure in organic chemistry with potential applications in various fields.
Formula:C11H14BrNO2
InChI:InChI=1S/C11H14BrNO2/c12-10-7-6-9(15-10)11(14)13-8-4-2-1-3-5-8/h6-8H,1-5H2,(H,13,14)
InChI key:InChIKey=PIYUOQBROIUTOD-UHFFFAOYSA-N
SMILES:C(NC1CCCCC1)(=O)C=2OC(Br)=CC2
Synonyms:
  • 2-furancarboxamide, 5-bromo-N-cyclohexyl-
  • 5-Bromo-N-cyclohexyl-2-furamide
  • 5-Bromo-N-cyclohexyl-2-furancarboxamide
Found 1 products.