CymitQuimica logo

CAS 117846-58-9

:

2,6-Dibromo-3,5-dimethylpyridine

Description:
2,6-Dibromo-3,5-dimethylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two bromine atoms and two methyl groups. The presence of bromine atoms at the 2 and 6 positions, along with methyl groups at the 3 and 5 positions, contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its moderate polarity due to the electronegative bromine atoms, which can influence its reactivity and solubility in various solvents. 2,6-Dibromo-3,5-dimethylpyridine may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its synthesis often involves bromination reactions and can be utilized in various chemical transformations, including nucleophilic substitutions. Safety precautions should be taken when handling this compound, as brominated compounds can be hazardous. Overall, its structural features and reactivity make it a valuable compound in organic synthesis and research applications.
Formula:C7H7Br2N
InChI:InChI=1S/C7H7Br2N/c1-4-3-5(2)7(9)10-6(4)8/h3H,1-2H3
InChI key:InChIKey=ILHNZRHAVNCIFX-UHFFFAOYSA-N
SMILES:CC1=C(Br)N=C(Br)C(C)=C1
Synonyms:
  • 2,6-Dibromo-3,5-Dimethylpyridine
  • 2,6-Dibromo-3,5-lutidine
  • Pyridine, 2,6-Dibromo-3,5-Dimethyl-
Found 4 products.