CymitQuimica logo

CAS 117890-81-0

:

4-chloro-7-methylpyrido[2,3-d]pyrimidine

Description:
4-Chloro-7-methylpyrido[2,3-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyridine and pyrimidine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 4-position and a methyl group at the 7-position enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale yellow to brownish appearance and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. Its molecular structure allows for interactions with biological targets, making it a subject of interest in drug discovery. Additionally, 4-chloro-7-methylpyrido[2,3-d]pyrimidine may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, which are common in heterocyclic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C8H6ClN3
InChI:InChI=1S/C8H6ClN3/c1-5-2-3-6-7(9)10-4-11-8(6)12-5/h2-4H,1H3
InChI key:WIFRGDCMHQEADW-UHFFFAOYSA-N
SMILES:CC1=NC2=C(C=C1)C(=NC=N2)Cl
Found 1 products.