CymitQuimica logo

CAS 1179361-81-9

:

6-chloro-7-fluoro-2,3-dihydro-1H-inden-1-one

Description:
6-Chloro-7-fluoro-2,3-dihydro-1H-inden-1-one is an organic compound characterized by its unique bicyclic structure, which includes an indene moiety. The presence of chlorine and fluorine substituents at the 6 and 7 positions, respectively, contributes to its chemical reactivity and potential biological activity. This compound typically exhibits a ketone functional group, which can influence its polarity and solubility in various solvents. The dihydro form indicates that it has two hydrogen atoms added to the indene structure, affecting its stability and reactivity. Such halogenated compounds are often of interest in medicinal chemistry due to their potential pharmacological properties. Additionally, the specific arrangement of substituents can lead to interesting electronic properties, making it a candidate for further research in fields such as materials science and drug development. Overall, 6-chloro-7-fluoro-2,3-dihydro-1H-inden-1-one is a compound with distinctive structural features that may have significant implications in various chemical applications.
Formula:C9H6ClFO
InChI:InChI=1S/C9H6ClFO/c10-6-3-1-5-2-4-7(12)8(5)9(6)11/h1,3H,2,4H2
InChI key:DWOJVTYJLHIUFI-UHFFFAOYSA-N
SMILES:c1cc(c(c2c1CCC2=O)F)Cl
Found 4 products.