CymitQuimica logo

CAS 1179362-16-3

:

1,2,4-Thiadiazol-5-amine, 3-(3-chloro-2-pyridinyl)-

Description:
1,2,4-Thiadiazol-5-amine, 3-(3-chloro-2-pyridinyl)- is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a pyridine moiety. The thiadiazole ring contributes to its potential biological activity, often associated with compounds that exhibit antimicrobial, antifungal, or herbicidal properties. The presence of the 3-chloro-2-pyridinyl group enhances its reactivity and may influence its interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where the combination of the thiadiazole and pyridine functionalities can lead to diverse biological activities. Safety and handling precautions are essential, as with many nitrogen-containing heterocycles, due to potential toxicity or environmental impact. Further studies would be necessary to fully elucidate its properties, including stability, reactivity, and specific applications in various fields.
Formula:C7H5ClN4S
InChI:InChI=1S/C7H5ClN4S/c8-4-2-1-3-10-5(4)6-11-7(9)13-12-6/h1-3H,(H2,9,11,12)
InChI key:InChIKey=IBAHKYGFMMMYEW-UHFFFAOYSA-N
SMILES:ClC1=C(N=CC=C1)C=2N=C(N)SN2
Synonyms:
  • 3-(3-Chloropyridin-2-yl)-1,2,4-thiadiazol-5-amine
  • 1,2,4-Thiadiazol-5-amine, 3-(3-chloro-2-pyridinyl)-
  • 3-(3-chloro-2-pyridinyl)-1,2,4-Thiadiazol-5-amine
Found 1 products.