CymitQuimica logo

CAS 117943-37-0

:

1,2-difluoro-4-[4-[2-(4-propylcyclohexyl)ethyl]cyclohexyl]benzene

Description:
1,2-Difluoro-4-[4-[2-(4-propylcyclohexyl)ethyl]cyclohexyl]benzene, with CAS number 117943-37-0, is an organic compound characterized by its complex molecular structure, which includes multiple cyclohexyl groups and fluorine substituents. This compound features a biphenyl framework, where one of the benzene rings is substituted with two fluorine atoms at the 1 and 2 positions, enhancing its chemical reactivity and potentially influencing its physical properties such as boiling and melting points. The presence of the propylcyclohexyl group contributes to its hydrophobic characteristics, making it less soluble in polar solvents. Additionally, the steric bulk from the cyclohexyl groups may affect its conformational flexibility and interactions with other molecules. This compound may be of interest in materials science or medicinal chemistry due to its unique structural features, which could impart specific electronic or steric properties beneficial for various applications. However, detailed studies would be necessary to fully understand its behavior and potential uses in different chemical contexts.
Formula:C23H34F2
InChI:InChI=1/C23H34F2/c1-2-3-17-4-6-18(7-5-17)8-9-19-10-12-20(13-11-19)21-14-15-22(24)23(25)16-21/h14-20H,2-13H2,1H3/t17-,18-,19-,20-
InChI key:HTAPXFSKUGZEEP-UHFFFAOYSA-N
SMILES:CCC[C@H]1CC[C@@H](CC1)CC[C@H]1CC[C@@H](CC1)c1ccc(c(c1)F)F
Synonyms:
  • 1,2-Difluoro-4-(Trans-4-(2-(Trans-4-Propylcyclohexyl)Ethyl)Cyclohexyl)Benzene
Found 3 products.