CymitQuimica logo

CAS 1179444-82-6

:

2-Chloro-5-(trifluoromethyl)aniline hydrochloride

Description:
2-Chloro-5-(trifluoromethyl)aniline hydrochloride is a chemical compound characterized by its aniline structure, which features an amino group (-NH2) attached to a benzene ring that also contains a chlorine atom and a trifluoromethyl group (-CF3). This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydrochloride salt form. The trifluoromethyl group imparts unique electronic properties, enhancing the compound's reactivity and potential applications in pharmaceuticals and agrochemicals. The chlorine substituent can influence the compound's biological activity and lipophilicity. As with many halogenated anilines, it is essential to handle this substance with care, as it may exhibit toxicity and environmental persistence. Proper safety measures should be taken when working with this compound, including the use of personal protective equipment and adherence to relevant regulations regarding hazardous materials.
Formula:C7H6Cl2F3N
InChI:InChI=1S/C7H5ClF3N.ClH/c8-5-2-1-4(3-6(5)12)7(9,10)11;/h1-3H,12H2;1H
InChI key:RQJRPJUZTWJZLA-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1C(F)(F)F)N)Cl.Cl
Found 4 products.