CymitQuimica logo

CAS 117997-81-6

:

Boc-DL-Glu(OBzl)-OH

Description:
Boc-DL-Glu(OBzl)-OH, with the CAS number 117997-81-6, is a derivative of glutamic acid, an amino acid that plays a crucial role in various biological processes. This compound features a tert-butyloxycarbonyl (Boc) protecting group, which is commonly used in peptide synthesis to protect the amino group, and a benzyl (OBzl) ester group attached to the carboxylic acid, enhancing its lipophilicity and stability. The presence of both the Boc and benzyl groups indicates that this compound is likely utilized in organic synthesis, particularly in the preparation of peptides or other complex molecules. It is typically a white to off-white solid, soluble in organic solvents, and may exhibit specific reactivity patterns due to the functional groups present. The compound's characteristics make it valuable in pharmaceutical research and development, especially in the context of drug design and synthesis. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with its use.
Formula:C17H23NO6
InChI:InChI=1S/C17H23NO6/c1-17(2,3)24-16(22)18-13(15(20)21)9-10-14(19)23-11-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3,(H,18,22)(H,20,21)
InChI key:AJDUMMXHVCMISJ-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC(CCC(=O)OCC1=CC=CC=C1)C(=O)O
Found 5 products.