CymitQuimica logo

CAS 1180112-41-7

:

1,7-Diazaspiro[3.5]nonane-7-carboxylic acid tert-butyl ester

Description:
1,7-Diazaspiro[3.5]nonane-7-carboxylic acid tert-butyl ester is a chemical compound characterized by its unique spirocyclic structure, which includes two nitrogen atoms incorporated into a bicyclic framework. This compound features a tert-butyl ester functional group, which enhances its lipophilicity and may influence its solubility and reactivity. The presence of the carboxylic acid moiety suggests potential for hydrogen bonding and reactivity in various chemical environments. The spiro structure contributes to its rigidity, which can affect its biological activity and interaction with other molecules. This compound may be of interest in medicinal chemistry and drug design due to its structural features that could facilitate interactions with biological targets. Additionally, the presence of nitrogen atoms may impart basicity, influencing its behavior in different pH environments. Overall, 1,7-Diazaspiro[3.5]nonane-7-carboxylic acid tert-butyl ester represents a complex organic molecule with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C10H22N2O2
InChI:InChI=1S/C12H22N2O2/c1-11(2,3)16-10(15)14-8-5-12(6-9-14)4-7-13-12/h13H,4-9H2,1-3H3
InChI key:JXQPSCYGAWSTQP-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC2(CCN2)CC1
Synonyms:
  • Tert-Butyl 1,7-Diazaspiro[3.5]Nonane-7-Carboxylate
Found 4 products.