CymitQuimica logo

CAS 118018-44-3

:

(R)-2-Methyl-1,1'-binaphthalene

Description:
(R)-2-Methyl-1,1'-binaphthalene is a chiral organic compound characterized by its unique structure, which consists of two naphthalene rings connected by a single bond, with a methyl group attached to one of the rings. This compound is notable for its optical activity due to the presence of a stereocenter, making it useful in asymmetric synthesis and as a chiral ligand in various chemical reactions. It typically exhibits a high melting point and is relatively stable under standard conditions. The compound is often utilized in the field of organic chemistry, particularly in the development of catalysts and in studies related to stereochemistry. Its solubility varies depending on the solvent, and it is generally more soluble in organic solvents than in water. Additionally, (R)-2-Methyl-1,1'-binaphthalene can participate in various chemical reactions, including electrophilic substitutions and coupling reactions, making it a valuable building block in the synthesis of more complex organic molecules.
Formula:C21H16
InChI:InChI=1S/C21H16/c1-15-13-14-17-8-3-5-11-19(17)21(15)20-12-6-9-16-7-2-4-10-18(16)20/h2-14H,1H3
InChI key:YJFPWGKKKSWQKZ-UHFFFAOYSA-N
SMILES:CC1=C(C2=CC=CC=C2C=C1)C3=CC=CC4=CC=CC=C43
Synonyms:
  • (R)-2-Methyl-1,1'-binaphthalene
  • (1R)-2- methyl -1,1'- binaphthyl
  • (1R)-2-Methyl-1,1'-binaphthalene
Found 3 products.