CymitQuimica logo

CAS 1180526-40-2

:

5-iodo-3-methyl-1H-indazole

Description:
5-Iodo-3-methyl-1H-indazole is a chemical compound characterized by its indazole core, which consists of a fused benzene and pyrazole ring structure. The presence of an iodine atom at the 5-position and a methyl group at the 3-position contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is of interest in various fields, including medicinal chemistry, due to its potential biological activities. The iodine substituent can enhance the compound's reactivity and influence its interaction with biological targets. Additionally, the methyl group may affect the compound's lipophilicity and overall pharmacokinetic profile. As with many halogenated compounds, 5-iodo-3-methyl-1H-indazole may also exhibit interesting electronic properties, making it a candidate for further research in drug development and material science. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity and environmental impact.
Formula:C8H7IN2
InChI:InChI=1S/C8H7IN2/c1-5-7-4-6(9)2-3-8(7)11-10-5/h2-4H,1H3,(H,10,11)
InChI key:LPOZBUHGHONMFU-UHFFFAOYSA-N
SMILES:CC1=C2C=C(C=CC2=NN1)I
Found 2 products.