CymitQuimica logo

CAS 118119-32-7

:

N-1-Fmoc-1,5-diaminopentane . HCl

Description:
N-1-Fmoc-1,5-diaminopentane hydrochloride, with the CAS number 118119-32-7, is a chemical compound commonly used in peptide synthesis and bioconjugation. It features a 1,5-diaminopentane backbone, which is a linear aliphatic chain with amino groups at both ends, providing it with the ability to form multiple bonds in peptide chains. The "Fmoc" (9-fluorenylmethoxycarbonyl) group is a protective group that is widely utilized in solid-phase peptide synthesis, allowing for selective deprotection under mild conditions. The hydrochloride form indicates that the compound is a salt, enhancing its solubility in polar solvents, which is advantageous for various laboratory applications. This compound is typically white to off-white in appearance and is stable under standard laboratory conditions. Its reactivity and functional groups make it a valuable intermediate in the synthesis of more complex biomolecules, particularly in the field of medicinal chemistry and drug development. Proper handling and storage are essential due to its potential reactivity and the need for safety precautions when working with amines and protective groups.
Formula:C20H24N2O2·HCl
InChI:InChI=1S/C20H24N2O2.ClH/c21-12-6-1-7-13-22-20(23)24-14-19-17-10-4-2-8-15(17)16-9-3-5-11-18(16)19;/h2-5,8-11,19H,1,6-7,12-14,21H2,(H,22,23);1H
InChI key:MYVDRDMFYHOZBJ-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCCCN.Cl
Found 3 products.