CymitQuimica logo

CAS 118133-15-6

:

1-(Ethoxycarbonyl)-4-Piperidinecarboxylic Acid

Description:
1-(Ethoxycarbonyl)-4-Piperidinecarboxylic Acid, with the CAS number 118133-15-6, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features an ethoxycarbonyl group and a carboxylic acid functional group, contributing to its potential as a versatile building block in organic synthesis. The presence of the ethoxycarbonyl group enhances its reactivity, making it useful in various chemical reactions, including esterification and amidation. The carboxylic acid functionality allows for hydrogen bonding and solubility in polar solvents, which can influence its behavior in biological systems and chemical reactions. Additionally, the piperidine moiety may impart certain pharmacological properties, making this compound of interest in medicinal chemistry. Overall, 1-(Ethoxycarbonyl)-4-Piperidinecarboxylic Acid is a compound with significant potential for applications in synthetic organic chemistry and drug development, owing to its unique structural features and functional groups.
Formula:C9H15NO4
InChI:InChI=1S/C9H15NO4/c1-2-14-9(13)10-5-3-7(4-6-10)8(11)12/h7H,2-6H2,1H3,(H,11,12)
InChI key:BVEBMPFJSMEGJX-UHFFFAOYSA-N
SMILES:CCOC(=O)N1CCC(CC1)C(=O)O
Synonyms:
  • 1,4-Piperidinedicarboxylic acid, 1-ethyl ester
  • 1-(Ethoxycarbonyl)Piperidine-4-Carboxylic Acid
Found 7 products.