CymitQuimica logo

CAS 1181458-60-5

:

β-Alanine, N-(2-methylpropyl)-, hydrochloride (1:1)

Description:
β-Alanine, N-(2-methylpropyl)-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a β-alanine backbone with a 2-methylpropyl group attached to the nitrogen atom. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it more stable for various applications. β-Alanine itself is a non-essential amino acid that plays a role in the synthesis of carnosine, a dipeptide important for muscle function and pH regulation during exercise. The presence of the 2-methylpropyl group may influence the compound's biological activity and pharmacokinetics. In terms of physical properties, it is likely to be a white crystalline powder, and it may exhibit hygroscopic behavior. The compound's applications could span areas such as biochemistry, pharmaceuticals, and possibly as a dietary supplement, particularly in contexts related to athletic performance and muscle endurance. As with any chemical substance, safety data and handling precautions should be consulted before use.
Formula:C7H15NO2·ClH
InChI:InChI=1S/C7H15NO2.ClH/c1-6(2)5-8-4-3-7(9)10;/h6,8H,3-5H2,1-2H3,(H,9,10);1H
InChI key:InChIKey=YUPVFCIEBDCSIY-UHFFFAOYSA-N
SMILES:C(NCC(C)C)CC(O)=O.Cl
Synonyms:
  • β-Alanine, N-(2-methylpropyl)-, hydrochloride (1:1)
Found 1 products.