CymitQuimica logo

CAS 1181458-61-6

:

Benzamide, 4-amino-2-chloro-N-(2-methoxyethyl)-, hydrochloride (1:1)

Description:
Benzamide, 4-amino-2-chloro-N-(2-methoxyethyl)-, hydrochloride (1:1) is a chemical compound characterized by its benzamide structure, which features an amine and a chloro substituent on the aromatic ring. The presence of the methoxyethyl group enhances its solubility and potential biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological effects would depend on its interaction with biological targets. Its molecular structure suggests potential for hydrogen bonding due to the amine and methoxy groups, influencing its reactivity and interaction with other molecules. Safety data and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings. Overall, this compound represents a unique combination of functional groups that may contribute to its utility in medicinal chemistry and related fields.
Formula:C10H13ClN2O2·ClH
InChI:InChI=1S/C10H13ClN2O2.ClH/c1-15-5-4-13-10(14)8-3-2-7(12)6-9(8)11;/h2-3,6H,4-5,12H2,1H3,(H,13,14);1H
InChI key:InChIKey=GMAWGTNROXGBSX-UHFFFAOYSA-N
SMILES:C(NCCOC)(=O)C1=C(Cl)C=C(N)C=C1.Cl
Synonyms:
  • Benzamide, 4-amino-2-chloro-N-(2-methoxyethyl)-, hydrochloride (1:1)
Found 1 products.