CymitQuimica logo

CAS 1181458-83-2

:

Piperidine, 4-(1H-pyrazol-1-yl)-, hydrochloride (1:2)

Description:
Piperidine, 4-(1H-pyrazol-1-yl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, and a pyrazole moiety, which is a five-membered ring containing two adjacent nitrogen atoms. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of both the piperidine and pyrazole groups suggests potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit various pharmacological properties, including potential effects on the central nervous system, but specific biological activities would depend on further research and characterization. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as well as any regulatory considerations associated with its use in research or industry.
Formula:C8H13N3·2ClH
InChI:InChI=1S/C8H13N3.2ClH/c1-4-10-11(7-1)8-2-5-9-6-3-8;;/h1,4,7-9H,2-3,5-6H2;2*1H
InChI key:InChIKey=LTPXWAXYEKDNKN-UHFFFAOYSA-N
SMILES:N1(C=CC=N1)C2CCNCC2.Cl
Synonyms:
  • Piperidine, 4-(1H-pyrazol-1-yl)-, hydrochloride (1:2)
Found 3 products.