CymitQuimica logo

CAS 118156-56-2

:

1-Piperidinecarboxylic acid, 4-(hydroxymethyl)-, ethyl ester

Description:
1-Piperidinecarboxylic acid, 4-(hydroxymethyl)-, ethyl ester, identified by CAS number 118156-56-2, is an organic compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group and an ethyl ester moiety, contributing to its reactivity and solubility properties. The presence of a hydroxymethyl group at the 4-position of the piperidine ring enhances its potential for hydrogen bonding and may influence its biological activity. Typically, compounds of this nature are studied for their applications in pharmaceuticals and agrochemicals due to their ability to interact with biological systems. The molecular structure suggests that it may exhibit moderate polarity, making it soluble in various organic solvents while potentially having limited solubility in water. Additionally, the compound's functional groups may allow for further derivatization, making it a versatile intermediate in synthetic chemistry. Overall, its unique structural features position it as a compound of interest in medicinal chemistry and related fields.
Formula:C9H17NO3
InChI:InChI=1S/C9H17NO3/c1-2-13-9(12)10-5-3-8(7-11)4-6-10/h8,11H,2-7H2,1H3
InChI key:YIDXEVJPPXFECF-UHFFFAOYSA-N
SMILES:CCOC(=O)N1CCC(CC1)CO
Found 5 products.