CymitQuimica logo

CAS 118157-05-4

:

1-(3-PHENYLPROPYL)-1,4-DIAZEPANEDIHYDROCHLORIDE

Description:
1-(3-Phenylpropyl)-1,4-diazepanedihydrochloride is a chemical compound characterized by its structure, which includes a diazepane ring—a seven-membered heterocyclic compound containing two nitrogen atoms. This substance features a phenylpropyl side chain, contributing to its potential biological activity. As a dihydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability for pharmacological applications. The compound may exhibit properties related to central nervous system activity, given the presence of the diazepane moiety, which is often associated with anxiolytic and sedative effects. Its specific interactions and efficacy would depend on its binding affinity to various receptors, which can be influenced by the phenylpropyl group. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or side effects. Overall, this compound is of interest in medicinal chemistry and pharmacology, particularly in the development of therapeutic agents.
Formula:C14H22N2
InChI:InChI=1S/C14H22N2/c1-2-6-14(7-3-1)8-4-11-16-12-5-9-15-10-13-16/h1-3,6-7,15H,4-5,8-13H2
InChI key:QUITYRPYRQXLRN-UHFFFAOYSA-N
SMILES:C1CNCCN(C1)CCCC2=CC=CC=C2
Synonyms:
  • 1-(3-Phenylpropyl)-1,4-Diazepane
Found 2 products.